4-n-Pentylphenylboronic acid
4-n-Pentylbenzeneboronic acid
CAS: 121219-12-3
Molecular Formula: C11H17BO2
4-n-Pentylphenylboronic acid - Names and Identifiers
| Name | 4-n-Pentylbenzeneboronic acid |
| Synonyms | AKOS BRN-0130 4-Amylbenzeneboronic acid P-PENTYLPHENYLBORONIC ACID 4-Pentylbenzeneboronic acid 4-n-Amylbenzeneboronic acid 4-PENTYLBENZENEBORONIC ACID (4-pentylphenyl)boronic acid 4-N-PENTYLPHENYLBORONIC ACID 4-n-Pentylphenylboronic acid (4-PENTYLPHENYL)BORONIC ACID 4-N-PENTYLBENZENEBORONIC ACID 4-n-Pentylbenzeneboronic acid 4-n-Amylbenzeneboronic acid~4-n-Pentylphenylboronic acid |
| CAS | 121219-12-3 |
| EINECS | 206-141-6 |
| InChI | InChI=1/C11H17BO2/c1-2-3-4-5-10-6-8-11(9-7-10)12(13)14/h6-9,13-14H,2-5H2,1H3 |
4-n-Pentylphenylboronic acid - Physico-chemical Properties
| Molecular Formula | C11H17BO2 |
| Molar Mass | 192.06 |
| Density | 1.01±0.1 g/cm3(Predicted) |
| Melting Point | 82-84°C |
| Boling Point | 328.0±35.0 °C(Predicted) |
| Flash Point | 152.2°C |
| Vapor Presure | 7.85E-05mmHg at 25°C |
| Appearance | Crystalline powder |
| BRN | 4782754 |
| pKa | 8.87±0.10(Predicted) |
| Storage Condition | Keep in dark place,Sealed in dry,Room Temperature |
| Refractive Index | 1.509 |
| MDL | MFCD00995151 |
4-n-Pentylphenylboronic acid - Risk and Safety
| Hazard Symbols | Xi - Irritant |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| HS Code | 29319090 |
| Hazard Class | IRRITANT |
4-n-Pentylphenylboronic acid - Introduction
4-n-pentylboronic acid is an organic compound with the chemical formula C11H15BO2. It is a derivative of phenylboronic acid in which an n-pentyl group replaces one hydrogen atom on the benzene ring. The following is a description of the nature, use, preparation and safety information of 4-n-pentylboronic acid:
Nature:
-Appearance: 4-n-pentylboronic acid is a colorless to white solid.
-Melting point and boiling point: Its melting point is about 75-79 degrees Celsius, and the boiling point is about 300 degrees Celsius.
-Solubility: 4-n-pentylboronic acid has a certain solubility, soluble in some organic solvents such as chloroform, dichloromethane, etc., but difficult to dissolve in water.
Use:
-4-pentylboronic acid is an important organic synthesis intermediate, which can be used to synthesize other organic compounds, such as drugs, dyes, etc.
-It is also commonly used in coordination chemistry and catalytic reactions as part of the establishment of coordination bonds or catalysts.
Preparation Method:
-4-n-pentylphenylboronic acid can generally be prepared by reacting phenylboronic acid with pentanol or n-pentyl bromide.
-The preparation method can also be through other synthesis routes, such as Pd-catalyzed reaction of pentane iodide with phenylboronic acid.
Safety Information:
-4-n-pentylboronic acid is generally considered to be relatively safe under normal conditions of use.
-As an organic compound, it may be irritating to the skin, eyes and respiratory tract, so appropriate protective measures should be taken when handling.
-During storage and use, care should be taken to avoid contact with oxidants, strong acids and other substances to avoid dangerous reactions.
-If taken by mistake or inhaled by mistake, seek medical help immediately and provide detailed chemical composition information.
Nature:
-Appearance: 4-n-pentylboronic acid is a colorless to white solid.
-Melting point and boiling point: Its melting point is about 75-79 degrees Celsius, and the boiling point is about 300 degrees Celsius.
-Solubility: 4-n-pentylboronic acid has a certain solubility, soluble in some organic solvents such as chloroform, dichloromethane, etc., but difficult to dissolve in water.
Use:
-4-pentylboronic acid is an important organic synthesis intermediate, which can be used to synthesize other organic compounds, such as drugs, dyes, etc.
-It is also commonly used in coordination chemistry and catalytic reactions as part of the establishment of coordination bonds or catalysts.
Preparation Method:
-4-n-pentylphenylboronic acid can generally be prepared by reacting phenylboronic acid with pentanol or n-pentyl bromide.
-The preparation method can also be through other synthesis routes, such as Pd-catalyzed reaction of pentane iodide with phenylboronic acid.
Safety Information:
-4-n-pentylboronic acid is generally considered to be relatively safe under normal conditions of use.
-As an organic compound, it may be irritating to the skin, eyes and respiratory tract, so appropriate protective measures should be taken when handling.
-During storage and use, care should be taken to avoid contact with oxidants, strong acids and other substances to avoid dangerous reactions.
-If taken by mistake or inhaled by mistake, seek medical help immediately and provide detailed chemical composition information.
Last Update：2024-04-09 20:49:11
Supplier List
Spot supply
Product Name: 4-n-Pentylbenzeneboronic Acid Visit Supplier Webpage Request for quotationCAS: 121219-12-3
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Spot supply
Product Name: 4-n-Pentylbenzeneboronic Acid Visit Supplier Webpage Request for quotationCAS: 121219-12-3
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
View History